CAS 873055-08-4 is the registry number for 2-(tert-Butyl)-6-nitroindoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-tert-butyl-6-nitro-2,3-dihydro-1H-indole (CAS 873055-08-4) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: 2-tert-butyl-6-nitro-2,3-dihydro-1H-indole. InChIKey: PMIRTQUVGWFMMQ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 2-tert-butyl-6-nitro-2,3-dihydro-1H-indole |
| InChIKey | PMIRTQUVGWFMMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CC2=C(N1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)