CAS 873443-66-4 appears in our catalog under these names: 2，6–Dichloro–4–(o–tolyl)nicotinonitrile, 2,6-Dichloro-4-(o-tolyl)nicotinonitrile, 97%. Offered by: GLPBio, AmBeed. Available pack sizes: 1g, 250mg.
2,6-dichloro-4-(2-methylphenyl)pyridine-3-carbonitrile (CAS 873443-66-4) is a chemical compound with the molecular formula C13H8Cl2N2 and a molecular weight of 263.12 g/mol. IUPAC name: 2,6-dichloro-4-(2-methylphenyl)pyridine-3-carbonitrile. InChIKey: HDFNZYMPHSNNQC-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2 |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | 2,6-dichloro-4-(2-methylphenyl)pyridine-3-carbonitrile |
| InChIKey | HDFNZYMPHSNNQC-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=NC(=C2C#N)Cl)Cl |
Computed by PubChem (NCBI)