CAS 874133-65-0 appears in our catalog under these names: 3-(4-Fluoro-2-methylphenyl)benzoic acid, 98%, 3-(4-Fluoro-2-methylphenyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
3-(4-fluoro-2-methylphenyl)benzoic acid (CAS 874133-65-0) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: 3-(4-fluoro-2-methylphenyl)benzoic acid. InChIKey: ONDXPXZFVLAWKG-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 3-(4-fluoro-2-methylphenyl)benzoic acid |
| InChIKey | ONDXPXZFVLAWKG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)