CAS 874219-23-5 appears in our catalog under these names: 3-(n-Butylcarbamoyl)-4-fluorophenylboronic acid, 98%, (3-(Butylcarbamoyl)-4-fluorophenyl)boronic acid, 98%, (3-(Butylcarbamoyl)-4-fluorophenyl)boronic acid, 95%, 95%, (3-(Butylcarbamoyl)-4-fluorophenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg.
[3-(butylcarbamoyl)-4-fluorophenyl]boronic acid (CAS 874219-23-5) is a chemical compound with the molecular formula C11H15BFNO3 and a molecular weight of 239.05 g/mol. IUPAC name: [3-(butylcarbamoyl)-4-fluorophenyl]boronic acid. InChIKey: FYINHVVQWXVREN-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO3 |
|---|---|
| Molecular weight | 239.05 g/mol |
| IUPAC name | [3-(butylcarbamoyl)-4-fluorophenyl]boronic acid |
| InChIKey | FYINHVVQWXVREN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)NCCCC)(O)O |
Computed by PubChem (NCBI)