CAS 874289-51-7 appears in our catalog under these names: N-t-Butyl 3-borono-4-fluorobenzamide, 96%, 5-(Tert-butylcarbmoyl)-2-fluorophenylboronic acid, 98%, 98%, (5-(tert-Butylcarbamoyl)-2-fluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
[5-(tert-butylcarbamoyl)-2-fluorophenyl]boronic acid (CAS 874289-51-7) is a chemical compound with the molecular formula C11H15BFNO3 and a molecular weight of 239.05 g/mol. IUPAC name: [5-(tert-butylcarbamoyl)-2-fluorophenyl]boronic acid. InChIKey: KKSGPXWRHLBCCW-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO3 |
|---|---|
| Molecular weight | 239.05 g/mol |
| IUPAC name | [5-(tert-butylcarbamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | KKSGPXWRHLBCCW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)