Products 87440-75-3
CAS 87440-75-3 is the registry number for Viteralone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(5S)-4,5-dimethyl-8-oxo-6,7-dihydro-5H-benzo[f][1]benzofuran-3-carbaldehyde (CAS 87440-75-3) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: (5S)-4,5-dimethyl-8-oxo-6,7-dihydro-5H-benzo[f][1]benzofuran-3-carbaldehyde. InChIKey: CTWSYQBTROEFSB-QMMMGPOBSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | (5S)-4,5-dimethyl-8-oxo-6,7-dihydro-5H-benzo[f][1]benzofuran-3-carbaldehyde |
| InChIKey | CTWSYQBTROEFSB-QMMMGPOBSA-N |
| SMILES | C[C@H]1CCC(=O)C2=CC3=C(C(=C12)C)C(=CO3)C=O |
Computed by PubChem (NCBI)