Products 874459-88-8
CAS 874459-88-8 is the registry number for (2-(Isopropylcarbamoyl)phenyl)boronic acid, 93%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[2-(propan-2-ylcarbamoyl)phenyl]boronic acid (CAS 874459-88-8) is a chemical compound with the molecular formula C10H14BNO3 and a molecular weight of 207.04 g/mol. IUPAC name: [2-(propan-2-ylcarbamoyl)phenyl]boronic acid. InChIKey: PSKYAGHGQAAYEB-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO3 |
|---|---|
| Molecular weight | 207.04 g/mol |
| IUPAC name | [2-(propan-2-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | PSKYAGHGQAAYEB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(=O)NC(C)C)(O)O |
Computed by PubChem (NCBI)