Products 87453-75-6
CAS 87453-75-6 appears in our catalog under these names: Benzydamine Impurity 6 (Benzydamine EP Impurity F ), Benzydamine hydrochloride EP Impurity F, 3-(Dimethylamino)propyl 2-aminobenzoate, 95%, 95%. Offered by: Hubei YoungXin, Biosynth, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-(dimethylamino)propyl 2-aminobenzoate (CAS 87453-75-6) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: 3-(dimethylamino)propyl 2-aminobenzoate. InChIKey: JMBRBIHREVBATA-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 3-(dimethylamino)propyl 2-aminobenzoate |
| InChIKey | JMBRBIHREVBATA-UHFFFAOYSA-N |
| SMILES | CN(C)CCCOC(=O)C1=CC=CC=C1N |
Computed by PubChem (NCBI)