CAS 874594-04-4 is the registry number for 2-(1-(Difluoromethyl)-1H-1,3-benzodiazol-2-yl)-1-(thiophen-2-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[1-(difluoromethyl)benzimidazol-2-yl]-1-thiophen-2-ylethanone (CAS 874594-04-4) is a chemical compound with the molecular formula C14H10F2N2OS and a molecular weight of 292.31 g/mol. IUPAC name: 2-[1-(difluoromethyl)benzimidazol-2-yl]-1-thiophen-2-ylethanone. InChIKey: AYIRZVBQLHRDAP-UHFFFAOYSA-N.
| Molecular formula | C14H10F2N2OS |
|---|---|
| Molecular weight | 292.31 g/mol |
| IUPAC name | 2-[1-(difluoromethyl)benzimidazol-2-yl]-1-thiophen-2-ylethanone |
| InChIKey | AYIRZVBQLHRDAP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2C(F)F)CC(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)