CAS 887267-30-3 is the registry number for 1-Benzoyl-3-(2,3-difluorophenyl)thiourea, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
N-[(2,3-difluorophenyl)carbamothioyl]benzamide (CAS 887267-30-3) is a chemical compound with the molecular formula C14H10F2N2OS and a molecular weight of 292.31 g/mol. IUPAC name: N-[(2,3-difluorophenyl)carbamothioyl]benzamide. InChIKey: FANZMKGTEDGNGH-UHFFFAOYSA-N.
| Molecular formula | C14H10F2N2OS |
|---|---|
| Molecular weight | 292.31 g/mol |
| IUPAC name | N-[(2,3-difluorophenyl)carbamothioyl]benzamide |
| InChIKey | FANZMKGTEDGNGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=C(C(=CC=C2)F)F |
Computed by PubChem (NCBI)