CAS 874754-21-9 is the registry number for Ethyl 4-carbamoyl-5-(2-chloroacetamido)-2-methylfuran-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 4-carbamoyl-5-[(2-chloroacetyl)amino]-2-methylfuran-3-carboxylate (CAS 874754-21-9) is a chemical compound with the molecular formula C11H13ClN2O5 and a molecular weight of 288.68 g/mol. IUPAC name: ethyl 4-carbamoyl-5-[(2-chloroacetyl)amino]-2-methylfuran-3-carboxylate. InChIKey: UOFLJWNRFMTFIH-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O5 |
|---|---|
| Molecular weight | 288.68 g/mol |
| IUPAC name | ethyl 4-carbamoyl-5-[(2-chloroacetyl)amino]-2-methylfuran-3-carboxylate |
| InChIKey | UOFLJWNRFMTFIH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=C1C(=O)N)NC(=O)CCl)C |
Computed by PubChem (NCBI)