CAS 874780-64-0 appears in our catalog under these names: N-(2,3-Dimethylphenyl)-1,3,5-triazine-2,4-diamine, 95%, N2-(2,3-Dimethylphenyl)-1,3,5-triazine-2,4-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-N-(2,3-dimethylphenyl)-1,3,5-triazine-2,4-diamine (CAS 874780-64-0) is a chemical compound with the molecular formula C11H13N5 and a molecular weight of 215.25 g/mol. IUPAC name: 2-N-(2,3-dimethylphenyl)-1,3,5-triazine-2,4-diamine. InChIKey: IEISGTUKTKBXKT-UHFFFAOYSA-N.
| Molecular formula | C11H13N5 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2-N-(2,3-dimethylphenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | IEISGTUKTKBXKT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC2=NC=NC(=N2)N)C |
Computed by PubChem (NCBI)