CAS 915924-87-7 is the registry number for 5-(3,4-Dimethylphenyl)-3-hydrazino-1,2,4-triazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[5-(3,4-dimethylphenyl)-1,2,4-triazin-3-yl]hydrazine (CAS 915924-87-7) is a chemical compound with the molecular formula C11H13N5 and a molecular weight of 215.25 g/mol. IUPAC name: [5-(3,4-dimethylphenyl)-1,2,4-triazin-3-yl]hydrazine. InChIKey: TYQWSOXRGLVXPF-UHFFFAOYSA-N.
| Molecular formula | C11H13N5 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | [5-(3,4-dimethylphenyl)-1,2,4-triazin-3-yl]hydrazine |
| InChIKey | TYQWSOXRGLVXPF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CN=NC(=N2)NN)C |
Computed by PubChem (NCBI)