CAS 874912-78-4 is the registry number for (R)–2–Amino–2–(anthracen–9–yl)ethan–1–ol hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2R)-2-amino-2-anthracen-9-ylethanol;hydrochloride (CAS 874912-78-4) is a chemical compound with the molecular formula C16H16ClNO and a molecular weight of 273.75 g/mol. IUPAC name: (2R)-2-amino-2-anthracen-9-ylethanol;hydrochloride. InChIKey: YDYIILJVVXUUBO-RSAXXLAASA-N.
| Molecular formula | C16H16ClNO |
|---|---|
| Molecular weight | 273.75 g/mol |
| IUPAC name | (2R)-2-amino-2-anthracen-9-ylethanol;hydrochloride |
| InChIKey | YDYIILJVVXUUBO-RSAXXLAASA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2[C@H](CO)N.Cl |
Computed by PubChem (NCBI)