CAS 875251-23-3 is the registry number for 1-(3,4-Dihydroxyphenyl)-3-hydroxy-1-propanone. Offered by: TRC. Available pack sizes: 250mg.
1-(3,4-dihydroxyphenyl)-3-hydroxypropan-1-one (CAS 875251-23-3) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 1-(3,4-dihydroxyphenyl)-3-hydroxypropan-1-one. InChIKey: RPNXDEQHSFSAHF-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 1-(3,4-dihydroxyphenyl)-3-hydroxypropan-1-one |
| InChIKey | RPNXDEQHSFSAHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CCO)O)O |
Computed by PubChem (NCBI)