CAS 875310-92-2 appears in our catalog under these names: Norpinane-1,5-diamine,dihydrochloride, 98%, Norpinane-1,5-diamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
Bicyclo[3.1.1]heptane-1,5-diamine;dihydrochloride (CAS 875310-92-2) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: bicyclo[3.1.1]heptane-1,5-diamine;dihydrochloride. InChIKey: ATVHMPXATDIGFE-UHFFFAOYSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | bicyclo[3.1.1]heptane-1,5-diamine;dihydrochloride |
| InChIKey | ATVHMPXATDIGFE-UHFFFAOYSA-N |
| SMILES | C1CC2(CC(C1)(C2)N)N.Cl.Cl |
Computed by PubChem (NCBI)