Products 875339-65-4
CAS 875339-65-4 is the registry number for (S)-1-(4-Bromobenzyl)pyrrolidin-3-ol, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3S)-1-[(4-bromophenyl)methyl]pyrrolidin-3-ol (CAS 875339-65-4) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: (3S)-1-[(4-bromophenyl)methyl]pyrrolidin-3-ol. InChIKey: PPZFUFKRHOBDAO-NSHDSACASA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | (3S)-1-[(4-bromophenyl)methyl]pyrrolidin-3-ol |
| InChIKey | PPZFUFKRHOBDAO-NSHDSACASA-N |
| SMILES | C1CN(C[C@H]1O)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)