CAS 87562-78-5 is the registry number for isobutyryl alkannin, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 10mg.
[(1S)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-methylpropanoate (CAS 87562-78-5) is a chemical compound with the molecular formula C20H22O6 and a molecular weight of 358.4 g/mol. IUPAC name: [(1S)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-methylpropanoate. InChIKey: BVRYLTBIGIAADD-INIZCTEOSA-N.
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | [(1S)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-methylpropanoate |
| InChIKey | BVRYLTBIGIAADD-INIZCTEOSA-N |
| SMILES | CC(C)C(=O)O[C@@H](CC=C(C)C)C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O |
Computed by PubChem (NCBI)