Products 876-03-9
CAS 876-03-9 appears in our catalog under these names: 3–(Aminomethyl)benzoic acid, HCl, 3-(Aminomethyl)benzoic acid hydrochloride, 95% , 3-(Aminomethyl)benzoic acid hydrochloride, 97%, 97%, 3-(Aminomethyl)benzoic acid hydrochloride, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g, 25g, 100g.
3-(aminomethyl)benzoic acid;hydrochloride (CAS 876-03-9) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 3-(aminomethyl)benzoic acid;hydrochloride. InChIKey: SJCCOASSOPUHEN-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 3-(aminomethyl)benzoic acid;hydrochloride |
| InChIKey | SJCCOASSOPUHEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(Aminomethyl)benzoic acid hydrochloride, 3-Aminomethylbenzoic acid hydrochloride, 3-Aminomethylbenzoic acid HCl, 3-aminomethyl-benzoic acid hydrochloride, 3-(aminomethyl)benzoic acid;hydrochloride, 3-(Aminomethyl)benzoicacidhydrochloride, 3-(Aminomethyl)benzoic acid--hydrogen chloride (1/1), (3-Aminomethyl) benzoic acid hydrochloride, 3-(Aminomethy, SJCCOASSOPUHEN-UHFFFAOYSA-N