CAS 876-05-1 appears in our catalog under these names: rel-(1R,3S)-cyclopentane-1,3-dicarboxylic Acid, (1R,3S)–Cyclopentane–1,3–dicarboxylic acid, cis-Cyclopentane-1,3-dicarboxylic acid 95%, rel-(1R,3S)-1,3-Cyclopentanedicarboxylic acid, 97%, 97%, cis-1,3-Cyclopentanedicarboxylic acid, 97%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 5g, 25g, 100g, 100mg, 50g.
Cis-(1R,3S)-cyclopentane-1,3-dicarboxylic acid (CAS 876-05-1) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1R,3S)-cyclopentane-1,3-dicarboxylic acid. InChIKey: LNGJOYPCXLOTKL-SYDPRGILSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1R,3S)-cyclopentane-1,3-dicarboxylic acid |
| InChIKey | LNGJOYPCXLOTKL-SYDPRGILSA-N |
| SMILES | C1C[C@@H](C[C@@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)