CAS 87617-23-0 is the registry number for 2-Amino-5-methylbenzotrifluoride, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
4-methyl-2-(trifluoromethyl)aniline (CAS 87617-23-0) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: 4-methyl-2-(trifluoromethyl)aniline. InChIKey: JPPWLYYUBCTQMY-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | 4-methyl-2-(trifluoromethyl)aniline |
| InChIKey | JPPWLYYUBCTQMY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)