Products 87639-76-7
CAS 87639-76-7 is the registry number for N-trifluoroacetyl-β-alanyl chloride. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(2,2,2-trifluoroacetyl)amino]propanoyl chloride (CAS 87639-76-7) is a chemical compound with the molecular formula C5H5ClF3NO2 and a molecular weight of 203.55 g/mol. IUPAC name: 3-[(2,2,2-trifluoroacetyl)amino]propanoyl chloride. InChIKey: KCEFNIBAECYMBB-UHFFFAOYSA-N.
| Molecular formula | C5H5ClF3NO2 |
|---|---|
| Molecular weight | 203.55 g/mol |
| IUPAC name | 3-[(2,2,2-trifluoroacetyl)amino]propanoyl chloride |
| InChIKey | KCEFNIBAECYMBB-UHFFFAOYSA-N |
| SMILES | C(CNC(=O)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
N-(Trifluoroacetyl)-beta-alanyl chloride, Propanoyl chloride, 3-[(trifluoroacetyl)amino]-, N-trifluoroacetyl-beta-alanyl chloride, 3-[(2,2,2-trifluoroacetyl)amino]propanoyl chloride, N-trifluoroacetyl-|A-alanyl chloride, C5H5ClF3NO2, orb1984398, KCEFNIBAECYMBB-UHFFFAOYSA-N, N-trifluoroacetyl--alanyl chloride