CAS 876605-24-2 appears in our catalog under these names: 2-[(1R,3S)-Rel-3-hydroxycyclopentyl]acetic acid, 95%, 2-((1R,3S)-rel-3-Hydroxycyclopentyl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-[(1R,3S)-3-hydroxycyclopentyl]acetic acid (CAS 876605-24-2) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: 2-[(1R,3S)-3-hydroxycyclopentyl]acetic acid. InChIKey: IKGUMJUGKJCELW-RITPCOANSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | 2-[(1R,3S)-3-hydroxycyclopentyl]acetic acid |
| InChIKey | IKGUMJUGKJCELW-RITPCOANSA-N |
| SMILES | C1C[C@@H](C[C@@H]1CC(=O)O)O |
Computed by PubChem (NCBI)