CAS 877-01-0 appears in our catalog under these names: (1R)-2,3-Dihydro-1H-indene-1-carboxylic acid, 95%, (R)-Indane-1-carboxylic Acid, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g.
(1R)-2,3-dihydro-1H-indene-1-carboxylic acid (CAS 877-01-0) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: (1R)-2,3-dihydro-1H-indene-1-carboxylic acid. InChIKey: JBQMFBWTKWOSQX-SECBINFHSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | (1R)-2,3-dihydro-1H-indene-1-carboxylic acid |
| InChIKey | JBQMFBWTKWOSQX-SECBINFHSA-N |
| SMILES | C1CC2=CC=CC=C2[C@@H]1C(=O)O |
Computed by PubChem (NCBI)