Products 87810-63-7
CAS 87810-63-7 appears in our catalog under these names: H–Val–Ala–pNA, H-Val-Ala-pNA acetate salt, H-Val-Ala-pNA. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 5000mg, 2000mg, Get quote.
(2S)-2-amino-N-[(2S)-1-amino-1-oxopropan-2-yl]-3-methyl-N-(4-nitrophenyl)butanamide (CAS 87810-63-7) is a chemical compound with the molecular formula C14H20N4O4 and a molecular weight of 308.33 g/mol. IUPAC name: (2S)-2-amino-N-[(2S)-1-amino-1-oxopropan-2-yl]-3-methyl-N-(4-nitrophenyl)butanamide. InChIKey: UZWBDKNAAOJWOX-CABZTGNLSA-N.
| Molecular formula | C14H20N4O4 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | (2S)-2-amino-N-[(2S)-1-amino-1-oxopropan-2-yl]-3-methyl-N-(4-nitrophenyl)butanamide |
| InChIKey | UZWBDKNAAOJWOX-CABZTGNLSA-N |
| SMILES | C[C@@H](C(=O)N)N(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)[C@H](C(C)C)N |
Computed by PubChem (NCBI)
Synonyms:
H-VAL-ALA-PNA, H-Val-Ala-pNA acetate salt