CAS 878141-96-9 appears in our catalog under these names: 4-(2-{[5-Methyl-1-(naphthalen-2-yl)pyrazol-3-yl]oxy}ethyl)morpholine, 95%, S1RA/ 99.45% (existing batch purity), S1RA, E 52862 (S1RA), S1RA 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 250mg.
4-[2-(5-methyl-1-naphthalen-2-ylpyrazol-3-yl)oxyethyl]morpholine (CAS 878141-96-9) is a chemical compound with the molecular formula C20H23N3O2 and a molecular weight of 337.4 g/mol. IUPAC name: 4-[2-(5-methyl-1-naphthalen-2-ylpyrazol-3-yl)oxyethyl]morpholine. InChIKey: DGPGXHRHNRYVDH-UHFFFAOYSA-N.
| Molecular formula | C20H23N3O2 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 4-[2-(5-methyl-1-naphthalen-2-ylpyrazol-3-yl)oxyethyl]morpholine |
| InChIKey | DGPGXHRHNRYVDH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC3=CC=CC=C3C=C2)OCCN4CCOCC4 |
Computed by PubChem (NCBI)