Products 116839-68-0
CAS 116839-68-0 appears in our catalog under these names: Buntanetap, Posiphen, (3aR,8aS)-1,3a,8-Trimethyl-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indol-5-yl phenylcarbamate, 97%, 97%, Buntanetap, 99.71%, Buntanetap 97%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 10mg, 50mg, 2mg, 5mg, 25mg, 1mg, 25 mg, 10mM/1mL.
[(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate (CAS 116839-68-0) is a chemical compound with the molecular formula C20H23N3O2 and a molecular weight of 337.4 g/mol. IUPAC name: [(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate. InChIKey: PBHFNBQPZCRWQP-AZUAARDMSA-N.
| Molecular formula | C20H23N3O2 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | [(3aS,8bR)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate |
| InChIKey | PBHFNBQPZCRWQP-AZUAARDMSA-N |
| SMILES | C[C@]12CCN([C@H]1N(C3=C2C=C(C=C3)OC(=O)NC4=CC=CC=C4)C)C |
Computed by PubChem (NCBI)