Products 878417-25-5
CAS 878417-25-5 is the registry number for 3-{2,5-Dimethyl-7-oxo-3-phenyl-4H,7H-pyrazolo(1,5-a)pyrimidin-6-yl}propanoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-(2,5-dimethyl-7-oxo-3-phenyl-1H-pyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid (CAS 878417-25-5) is a chemical compound with the molecular formula C17H17N3O3 and a molecular weight of 311.33 g/mol. IUPAC name: 3-(2,5-dimethyl-7-oxo-3-phenyl-1H-pyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid. InChIKey: UPZQPRGGCOSNBA-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O3 |
|---|---|
| Molecular weight | 311.33 g/mol |
| IUPAC name | 3-(2,5-dimethyl-7-oxo-3-phenyl-1H-pyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid |
| InChIKey | UPZQPRGGCOSNBA-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC(=C(C(=O)N2N1)CCC(=O)O)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)