Products 87857-42-9
CAS 87857-42-9 is the registry number for BRL-26830A. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid (CAS 87857-42-9) is a chemical compound with the molecular formula C24H29NO6 and a molecular weight of 427.5 g/mol. IUPAC name: methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid. InChIKey: OIZISCUUSLPUEN-LMORPYAASA-N.
| Molecular formula | C24H29NO6 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | methyl 4-[(2S)-2-[[(2S)-2-hydroxy-2-phenylethyl]amino]propyl]benzoate;(E)-4-oxopent-2-enoic acid |
| InChIKey | OIZISCUUSLPUEN-LMORPYAASA-N |
| SMILES | C[C@@H](CC1=CC=C(C=C1)C(=O)OC)NC[C@H](C2=CC=CC=C2)O.CC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)