CAS 878748-66-4 is the registry number for 1-benzyl-2-(chloromethyl)-1H-benzo(d)imidazole hydrochloride. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
1-benzyl-2-(chloromethyl)benzimidazole;hydrochloride (CAS 878748-66-4) is a chemical compound with the molecular formula C15H14Cl2N2 and a molecular weight of 293.2 g/mol. IUPAC name: 1-benzyl-2-(chloromethyl)benzimidazole;hydrochloride. InChIKey: RLGNGUVFJAVOAA-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2N2 |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 1-benzyl-2-(chloromethyl)benzimidazole;hydrochloride |
| InChIKey | RLGNGUVFJAVOAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3N=C2CCl.Cl |
Computed by PubChem (NCBI)