CAS 879339-88-5 is the registry number for 1-(3-Fluoro-2-methoxyphenyl)propan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(3-fluoro-2-methoxyphenyl)propan-1-one (CAS 879339-88-5) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 1-(3-fluoro-2-methoxyphenyl)propan-1-one. InChIKey: DGNZZESRUQVBQA-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 1-(3-fluoro-2-methoxyphenyl)propan-1-one |
| InChIKey | DGNZZESRUQVBQA-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C(=CC=C1)F)OC |
Computed by PubChem (NCBI)