CAS 879487-92-0 appears in our catalog under these names: 2-(6-Bromopyridin-3-yl)-1,1,1-trifluoropropan-2-ol, 95%, 95%, 2-(6-Bromopyridin-3-yl)-1,1,1-trifluoropropan-2-ol, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(6-bromo-3-pyridinyl)-1,1,1-trifluoropropan-2-ol (CAS 879487-92-0) is a chemical compound with the molecular formula C8H7BrF3NO and a molecular weight of 270.05 g/mol. IUPAC name: 2-(6-bromo-3-pyridinyl)-1,1,1-trifluoropropan-2-ol. InChIKey: NSUFGFMEOJIOOW-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3NO |
|---|---|
| Molecular weight | 270.05 g/mol |
| IUPAC name | 2-(6-bromo-3-pyridinyl)-1,1,1-trifluoropropan-2-ol |
| InChIKey | NSUFGFMEOJIOOW-UHFFFAOYSA-N |
| SMILES | CC(C1=CN=C(C=C1)Br)(C(F)(F)F)O |
Computed by PubChem (NCBI)