Products 87954-40-3

CAS 87954-40-3 is the registry number for 3,3,5-Trimethylcyclohexyl acrylate, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3,3,5-trimethylcyclohexyl) prop-2-enoate (CAS 87954-40-3) is a chemical compound with the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. IUPAC name: (3,3,5-trimethylcyclohexyl) prop-2-enoate. InChIKey: ZMTBGVBNTHTBEC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O2
Molecular weight196.29 g/mol
IUPAC name(3,3,5-trimethylcyclohexyl) prop-2-enoate
InChIKeyZMTBGVBNTHTBEC-UHFFFAOYSA-N
SMILESCC1CC(CC(C1)(C)C)OC(=O)C=C

Computed by PubChem (NCBI)