Products 879609-79-7
CAS 879609-79-7 is the registry number for (2-((tert-Butoxycarbonyl)amino)-4-(trifluoromethyl)phenyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)phenyl]boronic acid (CAS 879609-79-7) is a chemical compound with the molecular formula C12H15BF3NO4 and a molecular weight of 305.06 g/mol. IUPAC name: [2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: XKUPYQIWBDNXAB-UHFFFAOYSA-N.
| Molecular formula | C12H15BF3NO4 |
|---|---|
| Molecular weight | 305.06 g/mol |
| IUPAC name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | XKUPYQIWBDNXAB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)