CAS 879641-96-0 is the registry number for 1,​7-​Dithia-​4-​azaspiro(4.4)​nonan-​3-​one, 4-​(phenylmethyl)​-​, 7,​7-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-benzyl-7,7-dioxo-1,7lambda6-dithia-4-azaspiro[4.4]nonan-3-one (CAS 879641-96-0) is a chemical compound with the molecular formula C13H15NO3S2 and a molecular weight of 297.4 g/mol. IUPAC name: 4-benzyl-7,7-dioxo-1,7lambda6-dithia-4-azaspiro[4.4]nonan-3-one. InChIKey: NFLZBELSPJFBGV-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3S2 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 4-benzyl-7,7-dioxo-1,7lambda6-dithia-4-azaspiro[4.4]nonan-3-one |
| InChIKey | NFLZBELSPJFBGV-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC12N(C(=O)CS2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)