CAS 879642-09-8 is the registry number for 4-(2-Methylphenyl)-1,7 (lambda)6-dithia-4-azaspiro(4.4)nonane-3,7,7-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2-methylphenyl)-7,7-dioxo-1,7lambda6-dithia-4-azaspiro[4.4]nonan-3-one (CAS 879642-09-8) is a chemical compound with the molecular formula C13H15NO3S2 and a molecular weight of 297.4 g/mol. IUPAC name: 4-(2-methylphenyl)-7,7-dioxo-1,7lambda6-dithia-4-azaspiro[4.4]nonan-3-one. InChIKey: PSEDKTRHDFFKIU-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3S2 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 4-(2-methylphenyl)-7,7-dioxo-1,7lambda6-dithia-4-azaspiro[4.4]nonan-3-one |
| InChIKey | PSEDKTRHDFFKIU-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C(=O)CSC23CCS(=O)(=O)C3 |
Computed by PubChem (NCBI)