CAS 880152-62-5 appears in our catalog under these names: Ramelteon Impurity 3, Ramelteon Impurity Q. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-[(8S)-7,8-dihydro-6H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide (CAS 880152-62-5) is a chemical compound with the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. IUPAC name: N-[2-[(8S)-7,8-dihydro-6H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide. InChIKey: MBBNFGRNNUHFSM-LBPRGKRZSA-N.
| Molecular formula | C16H19NO2 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | N-[2-[(8S)-7,8-dihydro-6H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide |
| InChIKey | MBBNFGRNNUHFSM-LBPRGKRZSA-N |
| SMILES | CCC(=O)NCC[C@@H]1CCC2=C1C3=C(C=C2)OC=C3 |
Computed by PubChem (NCBI)