Products 881189-64-6
CAS 881189-64-6 appears in our catalog under these names: 3-(4-Fluoro-3-methylphenyl)propionic acid 95%, Benzenepropanoicacid, 4-fluoro-3-methyl-, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g.
3-(4-fluoro-3-methylphenyl)propanoic acid (CAS 881189-64-6) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 3-(4-fluoro-3-methylphenyl)propanoic acid. InChIKey: CYLOSAIKMFNNEO-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 3-(4-fluoro-3-methylphenyl)propanoic acid |
| InChIKey | CYLOSAIKMFNNEO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CCC(=O)O)F |
Computed by PubChem (NCBI)