CAS 881588-58-5 appears in our catalog under these names: 1-Adamantylmethyl 4-aminobenzoate, 95%, Adamantan-1-ylmethyl 4-aminobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-adamantylmethyl 4-aminobenzoate (CAS 881588-58-5) is a chemical compound with the molecular formula C18H23NO2 and a molecular weight of 285.4 g/mol. IUPAC name: 1-adamantylmethyl 4-aminobenzoate. InChIKey: AKZAFEKEAUUIHN-UHFFFAOYSA-N.
| Molecular formula | C18H23NO2 |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 1-adamantylmethyl 4-aminobenzoate |
| InChIKey | AKZAFEKEAUUIHN-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)COC(=O)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)