CAS 29215-00-7 appears in our catalog under these names: Orphenadrine N-Oxide, Orphenadrine Impurity 9 (Orphenadrine N-Oxide). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N,N-dimethyl-2-[(2-methylphenyl)-phenylmethoxy]ethanamine oxide (CAS 29215-00-7) is a chemical compound with the molecular formula C18H23NO2 and a molecular weight of 285.4 g/mol. IUPAC name: N,N-dimethyl-2-[(2-methylphenyl)-phenylmethoxy]ethanamine oxide. InChIKey: XMSSICJSZNPVFX-UHFFFAOYSA-N.
| Molecular formula | C18H23NO2 |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | N,N-dimethyl-2-[(2-methylphenyl)-phenylmethoxy]ethanamine oxide |
| InChIKey | XMSSICJSZNPVFX-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(C2=CC=CC=C2)OCC[N+](C)(C)[O-] |
Computed by PubChem (NCBI)