CAS 881594-17-8 is the registry number for (3E)-4,6,7-Trimethyl-1-benzofuran-3(2h)-one oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(NE)-N-(4,6,7-trimethyl-1-benzofuran-3-ylidene)hydroxylamine (CAS 881594-17-8) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (NE)-N-(4,6,7-trimethyl-1-benzofuran-3-ylidene)hydroxylamine. InChIKey: AKCXJGFUOJUFSY-XFXZXTDPSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (NE)-N-(4,6,7-trimethyl-1-benzofuran-3-ylidene)hydroxylamine |
| InChIKey | AKCXJGFUOJUFSY-XFXZXTDPSA-N |
| SMILES | CC1=CC(=C2/C(=N\O)/COC2=C1C)C |
Computed by PubChem (NCBI)