Products 88170-22-3
CAS 88170-22-3 appears in our catalog under these names: Decanoic-d19 Acid, Decanoic-d19 Acid, 98 atom % D, min 98% Chemical Purity, Decanoic Acid–d19, Decanoic acid-d19, 98.4%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 250mg, 50mg, 1g, 0,5g, 100mg, 5mg, 10 mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecadeuteriodecanoic acid (CAS 88170-22-3) is a chemical compound with the molecular formula C10H20O2 and a molecular weight of 191.38 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecadeuteriodecanoic acid. InChIKey: GHVNFZFCNZKVNT-KIJKOTCYSA-N.
| Molecular formula | C10H20O2 |
|---|---|
| Molecular weight | 191.38 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecadeuteriodecanoic acid |
| InChIKey | GHVNFZFCNZKVNT-KIJKOTCYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)