CAS 881835-86-5 appears in our catalog under these names: 4,6–Dioxoheptanoic acid–13C5, SUCCINYLACETONE-3,4,5,6,7-13C5, 4,6-Dioxoheptanoic Acid-13C5, 4,6-DIOXOHEPTANOIC ACID-3,4,5,6,7-13C5,&, 4,6-Dioxoheptanoic acid-13C5, 99.8%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 5MG, 10MG, 10 mg, 1 mg, 5 mg.
4,6-dioxo(3,4,5,6,7-13C5)heptanoic acid (CAS 881835-86-5) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 163.12 g/mol. IUPAC name: 4,6-dioxo(3,4,5,6,7-13C5)heptanoic acid. InChIKey: WYEPBHZLDUPIOD-JBSMRZEESA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 163.12 g/mol |
| IUPAC name | 4,6-dioxo(3,4,5,6,7-13C5)heptanoic acid |
| InChIKey | WYEPBHZLDUPIOD-JBSMRZEESA-N |
| SMILES | [13CH3][13C](=O)[13CH2][13C](=O)[13CH2]CC(=O)O |
Computed by PubChem (NCBI)