CAS 882229-32-5 is the registry number for 2-({1-((2,6-dichlorophenyl)methyl)-4-formyl-3-methyl-1H-pyrazol-5-yl}sulfanyl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[1-[(2,6-dichlorophenyl)methyl]-4-formyl-3-methylpyrazol-5-yl]sulfanylacetic acid (CAS 882229-32-5) is a chemical compound with the molecular formula C14H12Cl2N2O3S and a molecular weight of 359.2 g/mol. IUPAC name: 2-[1-[(2,6-dichlorophenyl)methyl]-4-formyl-3-methylpyrazol-5-yl]sulfanylacetic acid. InChIKey: VVOOIDAUVKRQRP-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2N2O3S |
|---|---|
| Molecular weight | 359.2 g/mol |
| IUPAC name | 2-[1-[(2,6-dichlorophenyl)methyl]-4-formyl-3-methylpyrazol-5-yl]sulfanylacetic acid |
| InChIKey | VVOOIDAUVKRQRP-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C=O)SCC(=O)O)CC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)