Products 677327-00-3
CAS 677327-00-3 is the registry number for 4-[3-(4-Chlorophenyl)ureido]-2-methylbenzenesulfonyl chloride. Offered by: Fluorochem. Available pack sizes: 1g.
4-[(4-chlorophenyl)carbamoylamino]-2-methylbenzenesulfonyl chloride (CAS 677327-00-3) is a chemical compound with the molecular formula C14H12Cl2N2O3S and a molecular weight of 359.2 g/mol. IUPAC name: 4-[(4-chlorophenyl)carbamoylamino]-2-methylbenzenesulfonyl chloride. InChIKey: JRRFUUFVHYLYGP-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2N2O3S |
|---|---|
| Molecular weight | 359.2 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)carbamoylamino]-2-methylbenzenesulfonyl chloride |
| InChIKey | JRRFUUFVHYLYGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)NC2=CC=C(C=C2)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)