CAS 883195-38-8 is the registry number for 2-Amino-4H,5H,6H,7H,8H-cyclohepta(D)(1,3)thiazol-8-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-8-one (CAS 883195-38-8) is a chemical compound with the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. IUPAC name: 2-amino-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-8-one. InChIKey: NFAOGEPIABIIAN-UHFFFAOYSA-N.
| Molecular formula | C8H10N2OS |
|---|---|
| Molecular weight | 182.25 g/mol |
| IUPAC name | 2-amino-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-8-one |
| InChIKey | NFAOGEPIABIIAN-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C2=C(C1)N=C(S2)N |
Computed by PubChem (NCBI)