CAS 88339-43-9 is the registry number for 3-Acetyl-2,4,6-trimethylbenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-acetyl-2,4,6-trimethylbenzaldehyde (CAS 88339-43-9) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 3-acetyl-2,4,6-trimethylbenzaldehyde. InChIKey: OHFVIORELMJQOG-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 3-acetyl-2,4,6-trimethylbenzaldehyde |
| InChIKey | OHFVIORELMJQOG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C=O)C)C(=O)C)C |
Computed by PubChem (NCBI)