Products 883516-43-6

CAS 883516-43-6 is the registry number for 1-N-Boc-4-(3-aminomethylpyridyl)piperidine. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-[3-(aminomethyl)-2-pyridinyl]piperidine-1-carboxylate (CAS 883516-43-6) is a chemical compound with the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. IUPAC name: tert-butyl 4-[3-(aminomethyl)-2-pyridinyl]piperidine-1-carboxylate. InChIKey: MLZXYGQBPCNTJU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H25N3O2
Molecular weight291.39 g/mol
IUPAC nametert-butyl 4-[3-(aminomethyl)-2-pyridinyl]piperidine-1-carboxylate
InChIKeyMLZXYGQBPCNTJU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)C2=C(C=CC=N2)CN

Computed by PubChem (NCBI)