CAS 88398-58-7 is the registry number for 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3,5-dimethyl-1-phenylpyrazole-4-sulfonamide (CAS 88398-58-7) is a chemical compound with the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. IUPAC name: 3,5-dimethyl-1-phenylpyrazole-4-sulfonamide. InChIKey: LALRAHMHYBYUNC-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2S |
|---|---|
| Molecular weight | 251.31 g/mol |
| IUPAC name | 3,5-dimethyl-1-phenylpyrazole-4-sulfonamide |
| InChIKey | LALRAHMHYBYUNC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)S(=O)(=O)N |
Computed by PubChem (NCBI)