Products 884494-85-3
CAS 884494-85-3 appears in our catalog under these names: 5–Chloro–6–methoxynicotinic acid, 5-Chloro-6-methoxynicotinic acid, 98%, 98%, 5-Chloro-6-methoxynicotinic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 10g.
5-chloro-6-methoxypyridine-3-carboxylic acid (CAS 884494-85-3) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 5-chloro-6-methoxypyridine-3-carboxylic acid. InChIKey: FUBFUAARMGZWPE-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 5-chloro-6-methoxypyridine-3-carboxylic acid |
| InChIKey | FUBFUAARMGZWPE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)C(=O)O)Cl |
Computed by PubChem (NCBI)